C21H18N4O7 — CID 16821605
2-(1,3-dioxoisoindol-2-yl)-N-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]acetamide (PubChem CID 16821605) has the molecular formula C21H18N4O7 and a molecular weight of 438.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 16821605 |
| Molecular Formula | C21H18N4O7 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]acetamide |
| SMILES | COc1cc(-c2nnc(NC(=O)CN3C(=O)c4ccccc4C3=O)o2)cc(OC)c1OC |
| InChI | InChI=1S/C21H18N4O7/c1-29-14-8-11(9-15(30-2)17(14)31-3)18-23-24-21(32-18)22-16(26)10-25-19(27)12-6-4-5-7-13(12)20(25)28/h4-9H,10H2,1-3H3,(H,22,24,26) |
| InChIKey | PJVKXDLPKJGRNW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|