About N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide
N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide (PubChem CID 16823330) has the molecular formula C17H18N2O3S
and a molecular weight of 330.41 g/mol. Its IUPAC name is N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide |
| PubChem CID | 16823330 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide |
| SMILES | CC(=O)N1CCCc2ccc(NS(=O)(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C17H18N2O3S/c1-13(20)19-11-5-6-14-9-10-15(12-17(14)19)18-23(21,22)16-7-3-2-4-8-16/h2-4,7-10,12,18H,5-6,11H2,1H3 |
| InChIKey | SSXGOYLTJLFBLP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide?
The IUPAC name of N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide (CID 16823330) is N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide.
What is the SMILES notation for N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide?
The canonical SMILES for N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide is CC(=O)N1CCCc2ccc(NS(=O)(=O)c3ccccc3)cc21.
What is the InChIKey of N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide?
The InChIKey is SSXGOYLTJLFBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3S/c1-13(20)19-11-5-6-14-9-10-15(12-17(14)19)18-23(21,22)16-7-3-2-4-8-16/h2-4,7-10,12,18H,5-6,11H2,1H3.
What are the key properties of N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide?
N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide has a molecular weight of 330.41 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)benzenesulfonamide is sourced from PubChem (CID 16823330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).