About 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine
6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine (PubChem CID 16824016) has the molecular formula C13H11N3S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine |
| PubChem CID | 16824016 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine |
| SMILES | CSC1=Nc2cccnc2Nc2ccccc21 |
| InChI | InChI=1S/C13H11N3S/c1-17-13-9-5-2-3-6-10(9)15-12-11(16-13)7-4-8-14-12/h2-8H,1H3,(H,14,15) |
| InChIKey | LDMLJVUAYJUVNR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine?
The IUPAC name of 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine (CID 16824016) is 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine.
What is the SMILES notation for 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine?
The canonical SMILES for 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine is CSC1=Nc2cccnc2Nc2ccccc21.
What is the InChIKey of 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine?
The InChIKey is LDMLJVUAYJUVNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S/c1-17-13-9-5-2-3-6-10(9)15-12-11(16-13)7-4-8-14-12/h2-8H,1H3,(H,14,15).
What are the key properties of 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine?
6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine has a molecular weight of 241.32 g/mol, XLogP of 3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-11H-pyrido[2,3-b][1,4]benzodiazepine is sourced from PubChem (CID 16824016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).