About 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol
2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 16825) has the molecular formula C12H17Cl2NO5
and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol |
| PubChem CID | 16825 |
| Molecular Formula | C12H17Cl2NO5 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | O=C(O)COc1ccc(Cl)cc1Cl.OCCNCCO |
| InChI | InChI=1S/C8H6Cl2O3.C4H11NO2/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;6-3-1-5-2-4-7/h1-3H,4H2,(H,11,12);5-7H,1-4H2 |
| InChIKey | FDMDZIBZKGXZPT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol?
The IUPAC name of 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol (CID 16825) is 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol.
What is the SMILES notation for 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol?
The canonical SMILES for 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol is O=C(O)COc1ccc(Cl)cc1Cl.OCCNCCO.
What is the InChIKey of 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol?
The InChIKey is FDMDZIBZKGXZPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3.C4H11NO2/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;6-3-1-5-2-4-7/h1-3H,4H2,(H,11,12);5-7H,1-4H2.
What are the key properties of 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol?
2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol has a molecular weight of 326.18 g/mol, XLogP of 1.02, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenoxy)acetic acid;2-(2-hydroxyethylamino)ethanol is sourced from PubChem (CID 16825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).