C20H20N4O4S — CID 16825028
4-[2-(2,5-dioxo-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)ethyl]benzenesulfonamide (PubChem CID 16825028) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 4-[2-(2,5-dioxo-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(2,5-dioxo-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16825028 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[2-(2,5-dioxo-4-phenyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCN2CC3=C(C2=O)C(c2ccccc2)NC(=O)N3)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c21-29(27,28)15-8-6-13(7-9-15)10-11-24-12-16-17(19(24)25)18(23-20(26)22-16)14-4-2-1-3-5-14/h1-9,18H,10-12H2,(H2,21,27,28)(H2,22,23,26) |
| InChIKey | WFGDFUSZFWUBLH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |