C16H21N3O7S — CID 16825588
N'-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N-methyloxamide (PubChem CID 16825588) has the molecular formula C16H21N3O7S and a molecular weight of 399.43 g/mol. Its IUPAC name is N'-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N-methyloxamide.
| Compound Name | N'-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N-methyloxamide |
|---|---|
| PubChem CID | 16825588 |
| Molecular Formula | C16H21N3O7S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N'-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCC1OCCCN1S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H21N3O7S/c1-17-15(20)16(21)18-10-14-19(5-2-6-26-14)27(22,23)11-3-4-12-13(9-11)25-8-7-24-12/h3-4,9,14H,2,5-8,10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | SBLGVNMVCDIZEN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|