C21H26FN3O4S — CID 16825823
4-ethoxy-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]benzamide (PubChem CID 16825823) has the molecular formula C21H26FN3O4S and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]benzamide |
|---|---|
| PubChem CID | 16825823 |
| Molecular Formula | C21H26FN3O4S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-ethoxy-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCS(=O)(=O)N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C21H26FN3O4S/c1-2-29-18-9-7-17(8-10-18)21(26)23-11-16-30(27,28)25-14-12-24(13-15-25)20-6-4-3-5-19(20)22/h3-10H,2,11-16H2,1H3,(H,23,26) |
| InChIKey | ZSXLTIWZKNFWFN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |