C26H22N2O5S — CID 16827859
N-(9,10-dioxoanthracen-1-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 16827859) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16827859 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H22N2O5S/c1-16-11-13-17(14-12-16)34(32,33)28-15-5-10-22(28)26(31)27-21-9-4-8-20-23(21)25(30)19-7-3-2-6-18(19)24(20)29/h2-4,6-9,11-14,22H,5,10,15H2,1H3,(H,27,31) |
| InChIKey | DTUWNPXMEYFEJP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|