C24H26N2O6S2 — CID 16828633
N-(4-methoxynaphthalen-1-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16828633) has the molecular formula C24H26N2O6S2 and a molecular weight of 502.61 g/mol. Its IUPAC name is N-(4-methoxynaphthalen-1-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-methoxynaphthalen-1-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16828633 |
| Molecular Formula | C24H26N2O6S2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-(4-methoxynaphthalen-1-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(S(=O)(=O)c3cccc(S(C)(=O)=O)c3)CC2)c2ccccc12 |
| InChI | InChI=1S/C24H26N2O6S2/c1-32-23-11-10-22(20-8-3-4-9-21(20)23)25-24(27)17-12-14-26(15-13-17)34(30,31)19-7-5-6-18(16-19)33(2,28)29/h3-11,16-17H,12-15H2,1-2H3,(H,25,27) |
| InChIKey | AULXDAKFHBWKDD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |