C20H31N3O4S — CID 16829747
N-ethyl-N'-[2-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide (PubChem CID 16829747) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is N-ethyl-N'-[2-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide.
| Compound Name | N-ethyl-N'-[2-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 16829747 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-ethyl-N'-[2-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide |
| SMILES | CCNC(=O)C(=O)NCCC1CCCCN1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H31N3O4S/c1-5-21-19(24)20(25)22-10-9-17-8-6-7-11-23(17)28(26,27)18-15(3)12-14(2)13-16(18)4/h12-13,17H,5-11H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | QTZONVHDDRBWLU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|