C22H27N3O5S — CID 16829996
N-[[1-(2,5-dimethylphenyl)sulfonylpyrrolidin-2-yl]methyl]-N'-(4-methoxyphenyl)oxamide (PubChem CID 16829996) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[[1-(2,5-dimethylphenyl)sulfonylpyrrolidin-2-yl]methyl]-N'-(4-methoxyphenyl)oxamide.
| Compound Name | N-[[1-(2,5-dimethylphenyl)sulfonylpyrrolidin-2-yl]methyl]-N'-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 16829996 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[[1-(2,5-dimethylphenyl)sulfonylpyrrolidin-2-yl]methyl]-N'-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC2CCCN2S(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c1-15-6-7-16(2)20(13-15)31(28,29)25-12-4-5-18(25)14-23-21(26)22(27)24-17-8-10-19(30-3)11-9-17/h6-11,13,18H,4-5,12,14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | JQBPZZSBPFRGQR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|