C20H28O4 — CID 168300869
[(8R,9S)-8-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-yl]acetic acid (PubChem CID 168300869) has the molecular formula C20H28O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[(9S,10R)-10-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-yl]acetic acid.
| Compound Name | [(8R,9S)-8-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-yl]acetic acid |
|---|---|
| PubChem CID | 168300869 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[(9S,10R)-10-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-yl]acetic acid |
| SMILES | CC1(COC2(CC[C@H]([C@@H](C2)CC3=CC=CC=C3)CC(=O)O)OC1)C |
| InChI | InChI=1S/C20H28O4/c1-19(2)13-23-20(24-14-19)9-8-16(11-18(21)22)17(12-20)10-15-6-4-3-5-7-15/h3-7,16-17H,8-14H2,1-2H3,(H,21,22)/t16-,17+/m0/s1 |
| InChIKey | ZWXRAJFDAGPZAI-DLBZAZTESA-N |
| XLogP | 3.70 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | 429 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |