C27H24N2O6S — CID 16831891
N-(9,10-dioxoanthracen-2-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16831891) has the molecular formula C27H24N2O6S and a molecular weight of 504.56 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16831891 |
| Molecular Formula | C27H24N2O6S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc4c(c3)C(=O)c3ccccc3C4=O)CC2)cc1 |
| InChI | InChI=1S/C27H24N2O6S/c1-35-19-7-9-20(10-8-19)36(33,34)29-14-12-17(13-15-29)27(32)28-18-6-11-23-24(16-18)26(31)22-5-3-2-4-21(22)25(23)30/h2-11,16-17H,12-15H2,1H3,(H,28,32) |
| InChIKey | ZGQWPHRZKDHBOY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|