About N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide
N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide (PubChem CID 16832112) has the molecular formula C27H19NO4S
and a molecular weight of 453.52 g/mol. Its IUPAC name is N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide.
Molecular Properties
| Compound Name | N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide |
| PubChem CID | 16832112 |
| Molecular Formula | C27H19NO4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)N(Cc3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C27H19NO4S/c29-26-22-13-7-8-14-23(22)27(30)25-17-21(15-16-24(25)26)33(31,32)28(20-11-5-2-6-12-20)18-19-9-3-1-4-10-19/h1-17H,18H2 |
| InChIKey | UFPYUWMIUWADCJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide?
The IUPAC name of N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide (CID 16832112) is N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide.
What is the SMILES notation for N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide?
The canonical SMILES for N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide is O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)N(Cc3ccccc3)c3ccccc3)ccc21.
What is the InChIKey of N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide?
The InChIKey is UFPYUWMIUWADCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19NO4S/c29-26-22-13-7-8-14-23(22)27(30)25-17-21(15-16-24(25)26)33(31,32)28(20-11-5-2-6-12-20)18-19-9-3-1-4-10-19/h1-17H,18H2.
What are the key properties of N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide?
N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide has a molecular weight of 453.52 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-9,10-dioxo-N-phenylanthracene-2-sulfonamide is sourced from PubChem (CID 16832112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).