C24H23N5O2S — CID 16832574
2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-[2-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 16832574) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is 2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-[2-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-[2-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 16832574 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-[2-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1CCNC(=O)CSc1ccc(-c2ccc(-n3ccnc3)cc2)nn1 |
| InChI | InChI=1S/C24H23N5O2S/c1-31-22-5-3-2-4-19(22)12-13-26-23(30)16-32-24-11-10-21(27-28-24)18-6-8-20(9-7-18)29-15-14-25-17-29/h2-11,14-15,17H,12-13,16H2,1H3,(H,26,30) |
| InChIKey | AJXUXJWTEHYVEU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |