About propan-2-yl decanoate
propan-2-yl decanoate (PubChem CID 16833) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is propan-2-yl decanoate.
Molecular Properties
| Compound Name | propan-2-yl decanoate |
| PubChem CID | 16833 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | propan-2-yl decanoate |
| SMILES | CCCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C13H26O2/c1-4-5-6-7-8-9-10-11-13(14)15-12(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | PKPPDYGHKDIKBH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl decanoate?
The IUPAC name of propan-2-yl decanoate (CID 16833) is propan-2-yl decanoate.
What is the SMILES notation for propan-2-yl decanoate?
The canonical SMILES for propan-2-yl decanoate is CCCCCCCCCC(=O)OC(C)C.
What is the InChIKey of propan-2-yl decanoate?
The InChIKey is PKPPDYGHKDIKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-4-5-6-7-8-9-10-11-13(14)15-12(2)3/h12H,4-11H2,1-3H3.
What are the key properties of propan-2-yl decanoate?
propan-2-yl decanoate has a molecular weight of 214.35 g/mol, XLogP of 4.08, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl decanoate is sourced from PubChem (CID 16833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).