C25H25N3O3S2 — CID 16833533
4-[benzyl(propan-2-yl)sulfamoyl]-N-(2-methyl-1,3-benzothiazol-5-yl)benzamide (PubChem CID 16833533) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 4-[benzyl(propan-2-yl)sulfamoyl]-N-(2-methyl-1,3-benzothiazol-5-yl)benzamide.
| Compound Name | 4-[benzyl(propan-2-yl)sulfamoyl]-N-(2-methyl-1,3-benzothiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 16833533 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 4-[benzyl(propan-2-yl)sulfamoyl]-N-(2-methyl-1,3-benzothiazol-5-yl)benzamide |
| SMILES | Cc1nc2cc(NC(=O)c3ccc(S(=O)(=O)N(Cc4ccccc4)C(C)C)cc3)ccc2s1 |
| InChI | InChI=1S/C25H25N3O3S2/c1-17(2)28(16-19-7-5-4-6-8-19)33(30,31)22-12-9-20(10-13-22)25(29)27-21-11-14-24-23(15-21)26-18(3)32-24/h4-15,17H,16H2,1-3H3,(H,27,29) |
| InChIKey | COTICWUOYKCFGG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |