C25H23N3O6S2 — CID 16833573
4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 16833573) has the molecular formula C25H23N3O6S2 and a molecular weight of 525.61 g/mol. Its IUPAC name is 4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16833573 |
| Molecular Formula | C25H23N3O6S2 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3cc4ccccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C25H23N3O6S2/c1-28(14-18-6-4-12-33-18)36(31,32)19-10-8-16(9-11-19)23(29)27-25-26-21(15-35-25)20-13-17-5-2-3-7-22(17)34-24(20)30/h2-3,5,7-11,13,15,18H,4,6,12,14H2,1H3,(H,26,27,29) |
| InChIKey | STZXCTXFZRMWKW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|