C24H25N3O4 — CID 16839388
ethyl 1-(2-methylphenyl)-6-oxo-4-(2-phenylbutanoylamino)pyridazine-3-carboxylate (PubChem CID 16839388) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is ethyl 1-(2-methylphenyl)-6-oxo-4-(2-phenylbutanoylamino)pyridazine-3-carboxylate.
| Compound Name | ethyl 1-(2-methylphenyl)-6-oxo-4-(2-phenylbutanoylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16839388 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | ethyl 1-(2-methylphenyl)-6-oxo-4-(2-phenylbutanoylamino)pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2C)c(=O)cc1NC(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O4/c1-4-18(17-12-7-6-8-13-17)23(29)25-19-15-21(28)27(20-14-10-9-11-16(20)3)26-22(19)24(30)31-5-2/h6-15,18H,4-5H2,1-3H3,(H,25,29) |
| InChIKey | QURQUBCWKGNWTN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |