C22H29N3O4 — CID 16839503
ethyl 1-(4-methylphenyl)-6-oxo-4-(2-propylpentanoylamino)pyridazine-3-carboxylate (PubChem CID 16839503) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 1-(4-methylphenyl)-6-oxo-4-(2-propylpentanoylamino)pyridazine-3-carboxylate.
| Compound Name | ethyl 1-(4-methylphenyl)-6-oxo-4-(2-propylpentanoylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16839503 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | ethyl 1-(4-methylphenyl)-6-oxo-4-(2-propylpentanoylamino)pyridazine-3-carboxylate |
| SMILES | CCCC(CCC)C(=O)Nc1cc(=O)n(-c2ccc(C)cc2)nc1C(=O)OCC |
| InChI | InChI=1S/C22H29N3O4/c1-5-8-16(9-6-2)21(27)23-18-14-19(26)25(17-12-10-15(4)11-13-17)24-20(18)22(28)29-7-3/h10-14,16H,5-9H2,1-4H3,(H,23,27) |
| InChIKey | JASHHEQOIPMWQU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |