C17H15N5O5 — CID 16841353
N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-methyl-3-nitrobenzamide (PubChem CID 16841353) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-methyl-3-nitrobenzamide.
| Compound Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 16841353 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)Nc2ccnc3c2c(=O)n(C)c(=O)n3C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N5O5/c1-9-10(5-4-6-12(9)22(26)27)15(23)19-11-7-8-18-14-13(11)16(24)21(3)17(25)20(14)2/h4-8H,1-3H3,(H,18,19,23) |
| InChIKey | JCPQZLVOYAWUOM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|