About 2-chloro-N,N-diethylacetamide
2-chloro-N,N-diethylacetamide (PubChem CID 16844) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is 2-chloro-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethylacetamide |
| PubChem CID | 16844 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2-chloro-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CCl |
| InChI | InChI=1S/C6H12ClNO/c1-3-8(4-2)6(9)5-7/h3-5H2,1-2H3 |
| InChIKey | CQQUWTMMFMJEFE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethylacetamide?
The IUPAC name of 2-chloro-N,N-diethylacetamide (CID 16844) is 2-chloro-N,N-diethylacetamide.
What is the SMILES notation for 2-chloro-N,N-diethylacetamide?
The canonical SMILES for 2-chloro-N,N-diethylacetamide is CCN(CC)C(=O)CCl.
What is the InChIKey of 2-chloro-N,N-diethylacetamide?
The InChIKey is CQQUWTMMFMJEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO/c1-3-8(4-2)6(9)5-7/h3-5H2,1-2H3.
What are the key properties of 2-chloro-N,N-diethylacetamide?
2-chloro-N,N-diethylacetamide has a molecular weight of 149.62 g/mol, XLogP of 1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethylacetamide is sourced from PubChem (CID 16844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).