C18H24N4O5 — CID 16845308
5-[(2,5-dimethoxy-2H-furan-5-yl)methylamino]-6-ethyl-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 16845308) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-[(2,5-dimethoxy-2H-furan-5-yl)methylamino]-6-ethyl-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-[(2,5-dimethoxy-2H-furan-5-yl)methylamino]-6-ethyl-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16845308 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-[(2,5-dimethoxy-2H-furan-5-yl)methylamino]-6-ethyl-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCc1cnc2c(c1NCC1(OC)C=CC(OC)O1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H24N4O5/c1-6-11-9-19-15-13(16(23)22(3)17(24)21(15)2)14(11)20-10-18(26-5)8-7-12(25-4)27-18/h7-9,12H,6,10H2,1-5H3,(H,19,20) |
| InChIKey | GYQBOXBOBUIXEH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|