About 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride
4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride (PubChem CID 16849828) has the molecular formula C12H14Cl2N2O2S
and a molecular weight of 321.23 g/mol. Its IUPAC name is 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride.
Molecular Properties
| Compound Name | 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride |
| PubChem CID | 16849828 |
| Molecular Formula | C12H14Cl2N2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride |
| SMILES | COc1ccc(Cl)c2sc(N3CCOCC3)nc12.Cl |
| InChI | InChI=1S/C12H13ClN2O2S.ClH/c1-16-9-3-2-8(13)11-10(9)14-12(18-11)15-4-6-17-7-5-15;/h2-3H,4-7H2,1H3;1H |
| InChIKey | RJTOPLWHOOCDDA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride?
The IUPAC name of 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride (CID 16849828) is 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride.
What is the SMILES notation for 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride?
The canonical SMILES for 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride is COc1ccc(Cl)c2sc(N3CCOCC3)nc12.Cl.
What is the InChIKey of 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride?
The InChIKey is RJTOPLWHOOCDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2S.ClH/c1-16-9-3-2-8(13)11-10(9)14-12(18-11)15-4-6-17-7-5-15;/h2-3H,4-7H2,1H3;1H.
What are the key properties of 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride?
4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride has a molecular weight of 321.23 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)morpholine;hydrochloride is sourced from PubChem (CID 16849828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).