C12H15N3O2 — CID 168500301
1-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-ethynylpyrrolidin-2-one (PubChem CID 168500301) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168500301 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2nnc(C(C)(C)C)o2)C1 |
| InChI | InChI=1S/C12H15N3O2/c1-5-8-6-9(16)15(7-8)11-14-13-10(17-11)12(2,3)4/h1,8H,6-7H2,2-4H3 |
| InChIKey | HZORWSAOEXINMJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|