C16H12N4O — CID 168502484
5-(4-ethynyl-2-oxopyrrolidin-1-yl)-1-phenylpyrazole-4-carbonitrile (PubChem CID 168502484) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-(4-ethynyl-2-oxopyrrolidin-1-yl)-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-(4-ethynyl-2-oxopyrrolidin-1-yl)-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 168502484 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(4-ethynyl-2-oxopyrrolidin-1-yl)-1-phenylpyrazole-4-carbonitrile |
| SMILES | C#CC1CC(=O)N(c2c(C#N)cnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C16H12N4O/c1-2-12-8-15(21)19(11-12)16-13(9-17)10-18-20(16)14-6-4-3-5-7-14/h1,3-7,10,12H,8,11H2 |
| InChIKey | XPPXIQLTRVLEJH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|