C10H9N3O2 — CID 168502746
4-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 168502746) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168502746 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 4-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | C#CC1CC(=O)N(c2cc(=O)[nH]cn2)C1 |
| InChI | InChI=1S/C10H9N3O2/c1-2-7-3-10(15)13(5-7)8-4-9(14)12-6-11-8/h1,4,6-7H,3,5H2,(H,11,12,14) |
| InChIKey | ASIMEUVKXUICIN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|