C11H8F3N3O — CID 168503043
4-ethynyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one (PubChem CID 168503043) has the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. Its IUPAC name is 4-ethynyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503043 |
| Molecular Formula | C11H8F3N3O |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-ethynyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C11H8F3N3O/c1-2-7-5-9(18)17(6-7)10-15-4-3-8(16-10)11(12,13)14/h1,3-4,7H,5-6H2 |
| InChIKey | UHWYPQWWPXGHPR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|