C16H17BrN2O — CID 168504997
4-(bromomethyl)-1-(2-isoquinolin-3-ylethyl)pyrrolidin-2-one (PubChem CID 168504997) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2-isoquinolin-3-ylethyl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(2-isoquinolin-3-ylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168504997 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-(bromomethyl)-1-(2-isoquinolin-3-ylethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1CCc1cc2ccccc2cn1 |
| InChI | InChI=1S/C16H17BrN2O/c17-9-12-7-16(20)19(11-12)6-5-15-8-13-3-1-2-4-14(13)10-18-15/h1-4,8,10,12H,5-7,9,11H2 |
| InChIKey | FENPNYUFHUBCQC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|