C12H21ClN2O — CID 168506636
4-(chloromethyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]pyrrolidin-2-one (PubChem CID 168506636) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506636 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-(chloromethyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]pyrrolidin-2-one |
| SMILES | CCN1CCCC1CN1CC(CCl)CC1=O |
| InChI | InChI=1S/C12H21ClN2O/c1-2-14-5-3-4-11(14)9-15-8-10(7-13)6-12(15)16/h10-11H,2-9H2,1H3 |
| InChIKey | SKCUEDFYWYTINO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|