C15H20ClN3O3 — CID 168506921
tert-butyl N-[6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]carbamate (PubChem CID 168506921) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is tert-butyl N-[6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 168506921 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | tert-butyl N-[6-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(N2CC(CCl)CC2=O)n1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-15(2,3)22-14(21)18-11-5-4-6-12(17-11)19-9-10(8-16)7-13(19)20/h4-6,10H,7-9H2,1-3H3,(H,17,18,21) |
| InChIKey | CBJRTFNMTIUZGE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|