About 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one
7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one (PubChem CID 168510248) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one |
| PubChem CID | 168510248 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one |
| SMILES | COc1ccc(-c2ccc3c(C)cc(=O)n(C)c3c2)c(OC)n1 |
| InChI | InChI=1S/C18H18N2O3/c1-11-9-17(21)20(2)15-10-12(5-6-13(11)15)14-7-8-16(22-3)19-18(14)23-4/h5-10H,1-4H3 |
| InChIKey | NFFBUIFLOKMWKQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one?
The IUPAC name of 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one (CID 168510248) is 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one.
What is the SMILES notation for 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one?
The canonical SMILES for 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one is COc1ccc(-c2ccc3c(C)cc(=O)n(C)c3c2)c(OC)n1.
What is the InChIKey of 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one?
The InChIKey is NFFBUIFLOKMWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3/c1-11-9-17(21)20(2)15-10-12(5-6-13(11)15)14-7-8-16(22-3)19-18(14)23-4/h5-10H,1-4H3.
What are the key properties of 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one?
7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one has a molecular weight of 310.35 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one is sourced from PubChem (CID 168510248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).