C17H15NO8S — CID 168511859
6-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 168511859) has the molecular formula C17H15NO8S and a molecular weight of 393.37 g/mol. Its IUPAC name is 6-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 168511859 |
| Molecular Formula | C17H15NO8S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 6-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3cc(S(=O)(=O)O)cc(O)c3c2)C(=O)O1 |
| InChI | InChI=1S/C17H15NO8S/c1-17(2)25-15(20)13(16(21)26-17)8-18-10-4-3-9-5-11(27(22,23)24)7-14(19)12(9)6-10/h3-8,18-19H,1-2H3,(H,22,23,24) |
| InChIKey | LEKRKVXOYZLFOM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|