About 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine
1-(3-chloro-2,6-dimethylphenyl)pyrrolidine (PubChem CID 168514195) has the molecular formula C12H16ClN
and a molecular weight of 209.72 g/mol. Its IUPAC name is 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine |
| PubChem CID | 168514195 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine |
| SMILES | Cc1ccc(Cl)c(C)c1N1CCCC1 |
| InChI | InChI=1S/C12H16ClN/c1-9-5-6-11(13)10(2)12(9)14-7-3-4-8-14/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | FKIVSSXJSVOHFI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine?
The IUPAC name of 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine (CID 168514195) is 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine.
What is the SMILES notation for 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine?
The canonical SMILES for 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine is Cc1ccc(Cl)c(C)c1N1CCCC1.
What is the InChIKey of 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine?
The InChIKey is FKIVSSXJSVOHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN/c1-9-5-6-11(13)10(2)12(9)14-7-3-4-8-14/h5-6H,3-4,7-8H2,1-2H3.
What are the key properties of 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine?
1-(3-chloro-2,6-dimethylphenyl)pyrrolidine has a molecular weight of 209.72 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2,6-dimethylphenyl)pyrrolidine is sourced from PubChem (CID 168514195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).