C15H18N2O — CID 168514490
4,5-dimethyl-2-(2-pyrrolidin-1-ylphenyl)-1,3-oxazole (PubChem CID 168514490) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2-pyrrolidin-1-ylphenyl)-1,3-oxazole.
| Compound Name | 4,5-dimethyl-2-(2-pyrrolidin-1-ylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 168514490 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4,5-dimethyl-2-(2-pyrrolidin-1-ylphenyl)-1,3-oxazole |
| SMILES | Cc1nc(-c2ccccc2N2CCCC2)oc1C |
| InChI | InChI=1S/C15H18N2O/c1-11-12(2)18-15(16-11)13-7-3-4-8-14(13)17-9-5-6-10-17/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | MQVPUMRVJRFNGV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |