C14H19NO3S — CID 168514694
3-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid (PubChem CID 168514694) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid.
| Compound Name | 3-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 168514694 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2c(cc1N1CCCC1)CCCC2 |
| InChI | InChI=1S/C14H19NO3S/c16-19(17,18)14-10-12-6-2-1-5-11(12)9-13(14)15-7-3-4-8-15/h9-10H,1-8H2,(H,16,17,18) |
| InChIKey | RMGJIMODXKBRSW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|