C16H18N2O — CID 168514873
7-pyrrolidin-1-yl-2,3,4,9-tetrahydrocarbazol-1-one (PubChem CID 168514873) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 7-pyrrolidin-1-yl-2,3,4,9-tetrahydrocarbazol-1-one.
| Compound Name | 7-pyrrolidin-1-yl-2,3,4,9-tetrahydrocarbazol-1-one |
|---|---|
| PubChem CID | 168514873 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 7-pyrrolidin-1-yl-2,3,4,9-tetrahydrocarbazol-1-one |
| SMILES | O=C1CCCc2c1[nH]c1cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C16H18N2O/c19-15-5-3-4-13-12-7-6-11(18-8-1-2-9-18)10-14(12)17-16(13)15/h6-7,10,17H,1-5,8-9H2 |
| InChIKey | GAOFXFQVXJNESO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|