About 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione
2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione (PubChem CID 168516832) has the molecular formula C19H18N4O3
and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione |
| PubChem CID | 168516832 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione |
| SMILES | CN(C)c1cc2c(cc1N1C(=O)c3ccccc3C1=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H18N4O3/c1-20(2)13-9-14-15(22(4)19(26)21(14)3)10-16(13)23-17(24)11-7-5-6-8-12(11)18(23)25/h5-10H,1-4H3 |
| InChIKey | LRXRSYMRUZCBLF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione?
The IUPAC name of 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione (CID 168516832) is 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione.
What is the SMILES notation for 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione?
The canonical SMILES for 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione is CN(C)c1cc2c(cc1N1C(=O)c3ccccc3C1=O)n(C)c(=O)n2C.
What is the InChIKey of 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione?
The InChIKey is LRXRSYMRUZCBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O3/c1-20(2)13-9-14-15(22(4)19(26)21(14)3)10-16(13)23-17(24)11-7-5-6-8-12(11)18(23)25/h5-10H,1-4H3.
What are the key properties of 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione?
2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione has a molecular weight of 350.38 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(dimethylamino)-1,3-dimethyl-2-oxobenzimidazol-5-yl]isoindole-1,3-dione is sourced from PubChem (CID 168516832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).