C19H18N2O3 — CID 168517550
3-[2-(1,3-dioxoisoindol-2-yl)phenyl]-N,N-dimethylpropanamide (PubChem CID 168517550) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[2-(1,3-dioxoisoindol-2-yl)phenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[2-(1,3-dioxoisoindol-2-yl)phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 168517550 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[2-(1,3-dioxoisoindol-2-yl)phenyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCc1ccccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H18N2O3/c1-20(2)17(22)12-11-13-7-3-6-10-16(13)21-18(23)14-8-4-5-9-15(14)19(21)24/h3-10H,11-12H2,1-2H3 |
| InChIKey | MTPDLFUNZUMIDA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|