C21H19N3O2 — CID 168518415
5-(1,3-dioxoisoindol-2-yl)-2-(3-methylpiperidin-1-yl)benzonitrile (PubChem CID 168518415) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-2-(3-methylpiperidin-1-yl)benzonitrile.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-2-(3-methylpiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 168518415 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-2-(3-methylpiperidin-1-yl)benzonitrile |
| SMILES | CC1CCCN(c2ccc(N3C(=O)c4ccccc4C3=O)cc2C#N)C1 |
| InChI | InChI=1S/C21H19N3O2/c1-14-5-4-10-23(13-14)19-9-8-16(11-15(19)12-22)24-20(25)17-6-2-3-7-18(17)21(24)26/h2-3,6-9,11,14H,4-5,10,13H2,1H3 |
| InChIKey | SLMULZUOUDTGHK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|