C22H13ClN2O4 — CID 168518766
2-[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]isoindole-1,3-dione (PubChem CID 168518766) has the molecular formula C22H13ClN2O4 and a molecular weight of 404.81 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518766 |
| Molecular Formula | C22H13ClN2O4 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2nc3cc(N4C(=O)c5ccccc5C4=O)ccc3o2)cc1Cl |
| InChI | InChI=1S/C22H13ClN2O4/c1-28-18-8-6-12(10-16(18)23)20-24-17-11-13(7-9-19(17)29-20)25-21(26)14-4-2-3-5-15(14)22(25)27/h2-11H,1H3 |
| InChIKey | KFOGYXXIRMBOGQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|