C17H13NO4S — CID 168518809
2-(4-prop-2-enylsulfonylphenyl)isoindole-1,3-dione (PubChem CID 168518809) has the molecular formula C17H13NO4S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(4-prop-2-enylsulfonylphenyl)isoindole-1,3-dione.
| Compound Name | 2-(4-prop-2-enylsulfonylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518809 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-(4-prop-2-enylsulfonylphenyl)isoindole-1,3-dione |
| SMILES | C=CCS(=O)(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H13NO4S/c1-2-11-23(21,22)13-9-7-12(8-10-13)18-16(19)14-5-3-4-6-15(14)17(18)20/h2-10H,1,11H2 |
| InChIKey | IIZUSQRFXVFITJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|