About 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione
2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione (PubChem CID 168518820) has the molecular formula C15H9N3O2S
and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione |
| PubChem CID | 168518820 |
| Molecular Formula | C15H9N3O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione |
| SMILES | Nc1nc2cc(N3C(=O)c4ccccc4C3=O)ccc2s1 |
| InChI | InChI=1S/C15H9N3O2S/c16-15-17-11-7-8(5-6-12(11)21-15)18-13(19)9-3-1-2-4-10(9)14(18)20/h1-7H,(H2,16,17) |
| InChIKey | XHMVVUNMRARWMO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione?
The IUPAC name of 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione (CID 168518820) is 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione.
What is the SMILES notation for 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione?
The canonical SMILES for 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione is Nc1nc2cc(N3C(=O)c4ccccc4C3=O)ccc2s1.
What is the InChIKey of 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione?
The InChIKey is XHMVVUNMRARWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O2S/c16-15-17-11-7-8(5-6-12(11)21-15)18-13(19)9-3-1-2-4-10(9)14(18)20/h1-7H,(H2,16,17).
What are the key properties of 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione?
2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione has a molecular weight of 295.32 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-benzothiazol-5-yl)isoindole-1,3-dione is sourced from PubChem (CID 168518820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).