C16H10N2O3 — CID 168519413
2-(1,3-dioxoisoindol-2-yl)-4-hydroxy-3-methylbenzonitrile (PubChem CID 168519413) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-hydroxy-3-methylbenzonitrile.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-hydroxy-3-methylbenzonitrile |
|---|---|
| PubChem CID | 168519413 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-hydroxy-3-methylbenzonitrile |
| SMILES | Cc1c(O)ccc(C#N)c1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H10N2O3/c1-9-13(19)7-6-10(8-17)14(9)18-15(20)11-4-2-3-5-12(11)16(18)21/h2-7,19H,1H3 |
| InChIKey | FSVWPTUMRKXVGH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|