About 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide
3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 168519790) has the molecular formula C14H8Cl2N2O4S
and a molecular weight of 371.20 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| PubChem CID | 168519790 |
| Molecular Formula | C14H8Cl2N2O4S |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O4S/c15-10-5-7(23(17,21)22)6-11(16)12(10)18-13(19)8-3-1-2-4-9(8)14(18)20/h1-6H,(H2,17,21,22) |
| InChIKey | HTVOWCFXDXPNPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
The IUPAC name of 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (CID 168519790) is 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
What is the SMILES notation for 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
The canonical SMILES for 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide is NS(=O)(=O)c1cc(Cl)c(N2C(=O)c3ccccc3C2=O)c(Cl)c1.
What is the InChIKey of 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
The InChIKey is HTVOWCFXDXPNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2O4S/c15-10-5-7(23(17,21)22)6-11(16)12(10)18-13(19)8-3-1-2-4-9(8)14(18)20/h1-6H,(H2,17,21,22).
What are the key properties of 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide?
3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide has a molecular weight of 371.20 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide is sourced from PubChem (CID 168519790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).