C14H8Cl2N2O4S — CID 168519790
3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 168519790) has the molecular formula C14H8Cl2N2O4S and a molecular weight of 371.20 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 168519790 |
| Molecular Formula | C14H8Cl2N2O4S |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 3,5-dichloro-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O4S/c15-10-5-7(23(17,21)22)6-11(16)12(10)18-13(19)8-3-1-2-4-9(8)14(18)20/h1-6H,(H2,17,21,22) |
| InChIKey | HTVOWCFXDXPNPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|