C22H22N4O2 — CID 168522760
2-cyano-N-[4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 168522760) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-cyano-N-[4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 168522760 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-cyano-N-[4-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(N2CCN(C(=O)C=Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H22N4O2/c23-13-12-21(27)24-19-7-9-20(10-8-19)25-14-16-26(17-15-25)22(28)11-6-18-4-2-1-3-5-18/h1-11H,12,14-17H2,(H,24,27) |
| InChIKey | JQJOHCQSQICASE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|