About 2-(2-ethoxyphenyl)furan
2-(2-ethoxyphenyl)furan (PubChem CID 168524531) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)furan.
Molecular Properties
| Compound Name | 2-(2-ethoxyphenyl)furan |
| PubChem CID | 168524531 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(2-ethoxyphenyl)furan |
| SMILES | CCOc1ccccc1-c1ccco1 |
| InChI | InChI=1S/C12H12O2/c1-2-13-11-7-4-3-6-10(11)12-8-5-9-14-12/h3-9H,2H2,1H3 |
| InChIKey | GIDHSXCCHIWKPZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-ethoxyphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyphenyl)furan?
The IUPAC name of 2-(2-ethoxyphenyl)furan (CID 168524531) is 2-(2-ethoxyphenyl)furan.
What is the SMILES notation for 2-(2-ethoxyphenyl)furan?
The canonical SMILES for 2-(2-ethoxyphenyl)furan is CCOc1ccccc1-c1ccco1.
What is the InChIKey of 2-(2-ethoxyphenyl)furan?
The InChIKey is GIDHSXCCHIWKPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-13-11-7-4-3-6-10(11)12-8-5-9-14-12/h3-9H,2H2,1H3.
What are the key properties of 2-(2-ethoxyphenyl)furan?
2-(2-ethoxyphenyl)furan has a molecular weight of 188.23 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyphenyl)furan is sourced from PubChem (CID 168524531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).