C11H5Cl2NO — CID 168528808
2,3-dichloro-6-(furan-2-yl)benzonitrile (PubChem CID 168528808) has the molecular formula C11H5Cl2NO and a molecular weight of 238.07 g/mol. Its IUPAC name is 2,3-dichloro-6-(furan-2-yl)benzonitrile.
| Compound Name | 2,3-dichloro-6-(furan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 168528808 |
| Molecular Formula | C11H5Cl2NO |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 2,3-dichloro-6-(furan-2-yl)benzonitrile |
| SMILES | N#Cc1c(-c2ccco2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H5Cl2NO/c12-9-4-3-7(8(6-14)11(9)13)10-2-1-5-15-10/h1-5H |
| InChIKey | YIJFZTBIMXDUOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |