About (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine
(3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine (PubChem CID 168531130) has the molecular formula C7H4BrF3N2
and a molecular weight of 253.02 g/mol. Its IUPAC name is (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine.
Molecular Properties
| Compound Name | (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine |
| PubChem CID | 168531130 |
| Molecular Formula | C7H4BrF3N2 |
| Molecular Weight | 253.02 g/mol |
| Exact Mass | 251.95 |
| IUPAC Name | (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine |
| SMILES | NN=Cc1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C7H4BrF3N2/c8-5-6(10)3(2-13-12)1-4(9)7(5)11/h1-2H,12H2 |
| InChIKey | LWIFULOOWRGODQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.02 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine?
The IUPAC name of (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine (CID 168531130) is (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine.
What is the SMILES notation for (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine?
The canonical SMILES for (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine is NN=Cc1cc(F)c(F)c(Br)c1F.
What is the InChIKey of (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine?
The InChIKey is LWIFULOOWRGODQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3N2/c8-5-6(10)3(2-13-12)1-4(9)7(5)11/h1-2H,12H2.
What are the key properties of (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine?
(3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine has a molecular weight of 253.02 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2,4,5-trifluorophenyl)methylidenehydrazine is sourced from PubChem (CID 168531130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).