C7H6F2N2O — CID 168531641
2,4-difluoro-3-methanehydrazonoylphenol (PubChem CID 168531641) has the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. Its IUPAC name is 2,4-difluoro-3-methanehydrazonoylphenol.
| Compound Name | 2,4-difluoro-3-methanehydrazonoylphenol |
|---|---|
| PubChem CID | 168531641 |
| Molecular Formula | C7H6F2N2O |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2,4-difluoro-3-methanehydrazonoylphenol |
| SMILES | NN=Cc1c(F)ccc(O)c1F |
| InChI | InChI=1S/C7H6F2N2O/c8-5-1-2-6(12)7(9)4(5)3-11-10/h1-3,12H,10H2 |
| InChIKey | SABDEHMDCNWYPQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|